C18H21ClN2O2 — CID 67151520
N-[4-(3-amino-4-hydroxybutyl)phenyl]-4-chloro-N-methylbenzamide (PubChem CID 67151520) has the molecular formula C18H21ClN2O2 and a molecular weight of 332.83 g/mol. Its IUPAC name is N-[4-(3-amino-4-hydroxybutyl)phenyl]-4-chloro-N-methylbenzamide.
| Compound Name | N-[4-(3-amino-4-hydroxybutyl)phenyl]-4-chloro-N-methylbenzamide |
|---|---|
| PubChem CID | 67151520 |
| Molecular Formula | C18H21ClN2O2 |
| Molecular Weight | 332.83 g/mol |
| Exact Mass | 332.13 |
| IUPAC Name | N-[4-(3-amino-4-hydroxybutyl)phenyl]-4-chloro-N-methylbenzamide |
| SMILES | CN(C(=O)c1ccc(Cl)cc1)c1ccc(CCC(N)CO)cc1 |
| InChI | InChI=1S/C18H21ClN2O2/c1-21(18(23)14-5-7-15(19)8-6-14)17-10-3-13(4-11-17)2-9-16(20)12-22/h3-8,10-11,16,22H,2,9,12,20H2,1H3 |
| InChIKey | PWOCWOZRGLWHGJ-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 66.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.83 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |