C16H15ClN2O3S — CID 67833795
4-[1-(furan-2-yl)-2-imidazol-1-ylethyl]sulfanylbenzoic acid;hydrochloride (PubChem CID 67833795) has the molecular formula C16H15ClN2O3S and a molecular weight of 350.83 g/mol. Its IUPAC name is 4-[1-(furan-2-yl)-2-imidazol-1-ylethyl]sulfanylbenzoic acid;hydrochloride.
| Compound Name | 4-[1-(furan-2-yl)-2-imidazol-1-ylethyl]sulfanylbenzoic acid;hydrochloride |
|---|---|
| PubChem CID | 67833795 |
| Molecular Formula | C16H15ClN2O3S |
| Molecular Weight | 350.83 g/mol |
| Exact Mass | 350.05 |
| IUPAC Name | 4-[1-(furan-2-yl)-2-imidazol-1-ylethyl]sulfanylbenzoic acid;hydrochloride |
| SMILES | Cl.O=C(O)c1ccc(SC(Cn2ccnc2)c2ccco2)cc1 |
| InChI | InChI=1S/C16H14N2O3S.ClH/c19-16(20)12-3-5-13(6-4-12)22-15(14-2-1-9-21-14)10-18-8-7-17-11-18;/h1-9,11,15H,10H2,(H,19,20);1H |
| InChIKey | KANMUKREUIGRNP-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 68.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.83 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |