About benzoic acid;1-propylimidazole
benzoic acid;1-propylimidazole (PubChem CID 173073057) has the molecular formula C13H16N2O2
and a molecular weight of 232.28 g/mol. Its IUPAC name is benzoic acid;1-propylimidazole.
Molecular Properties
| Compound Name | benzoic acid;1-propylimidazole |
| PubChem CID | 173073057 |
| Molecular Formula | C13H16N2O2 |
| Molecular Weight | 232.28 g/mol |
| Exact Mass | 232.12 |
| IUPAC Name | benzoic acid;1-propylimidazole |
| SMILES | CCCn1ccnc1.O=C(O)c1ccccc1 |
| InChI | InChI=1S/C7H6O2.C6H10N2/c8-7(9)6-4-2-1-3-5-6;1-2-4-8-5-3-7-6-8/h1-5H,(H,8,9);3,5-6H,2,4H2,1H3 |
| InChIKey | VLYMCOOHCSESCM-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.28 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze benzoic acid;1-propylimidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzoic acid;1-propylimidazole?
The IUPAC name of benzoic acid;1-propylimidazole (CID 173073057) is benzoic acid;1-propylimidazole.
What is the SMILES notation for benzoic acid;1-propylimidazole?
The canonical SMILES for benzoic acid;1-propylimidazole is CCCn1ccnc1.O=C(O)c1ccccc1.
What is the InChIKey of benzoic acid;1-propylimidazole?
The InChIKey is VLYMCOOHCSESCM-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6O2.C6H10N2/c8-7(9)6-4-2-1-3-5-6;1-2-4-8-5-3-7-6-8/h1-5H,(H,8,9);3,5-6H,2,4H2,1H3.
What are the key properties of benzoic acid;1-propylimidazole?
benzoic acid;1-propylimidazole has a molecular weight of 232.28 g/mol, XLogP of 2.68, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for benzoic acid;1-propylimidazole is sourced from PubChem (CID 173073057), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).