About 1-propylimidazole;quinoline
1-propylimidazole;quinoline (PubChem CID 174946070) has the molecular formula C15H17N3
and a molecular weight of 239.32 g/mol. Its IUPAC name is 1-propylimidazole;quinoline.
Molecular Properties
| Compound Name | 1-propylimidazole;quinoline |
| PubChem CID | 174946070 |
| Molecular Formula | C15H17N3 |
| Molecular Weight | 239.32 g/mol |
| Exact Mass | 239.14 |
| IUPAC Name | 1-propylimidazole;quinoline |
| SMILES | CCCn1ccnc1.c1ccc2ncccc2c1 |
| InChI | InChI=1S/C9H7N.C6H10N2/c1-2-6-9-8(4-1)5-3-7-10-9;1-2-4-8-5-3-7-6-8/h1-7H;3,5-6H,2,4H2,1H3 |
| InChIKey | UQJJSEQYTIXQMI-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.32 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-propylimidazole;quinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-propylimidazole;quinoline?
The IUPAC name of 1-propylimidazole;quinoline (CID 174946070) is 1-propylimidazole;quinoline.
What is the SMILES notation for 1-propylimidazole;quinoline?
The canonical SMILES for 1-propylimidazole;quinoline is CCCn1ccnc1.c1ccc2ncccc2c1.
What is the InChIKey of 1-propylimidazole;quinoline?
The InChIKey is UQJJSEQYTIXQMI-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7N.C6H10N2/c1-2-6-9-8(4-1)5-3-7-10-9;1-2-4-8-5-3-7-6-8/h1-7H;3,5-6H,2,4H2,1H3.
What are the key properties of 1-propylimidazole;quinoline?
1-propylimidazole;quinoline has a molecular weight of 239.32 g/mol, XLogP of 3.53, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-propylimidazole;quinoline is sourced from PubChem (CID 174946070), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).