C19H16Cl2N2O3 — CID 167507029
4-[[1-(2,4-dichlorophenyl)-2-imidazol-1-ylethoxy]methyl]benzoic acid (PubChem CID 167507029) has the molecular formula C19H16Cl2N2O3 and a molecular weight of 391.25 g/mol. Its IUPAC name is 4-[[1-(2,4-dichlorophenyl)-2-imidazol-1-ylethoxy]methyl]benzoic acid.
| Compound Name | 4-[[1-(2,4-dichlorophenyl)-2-imidazol-1-ylethoxy]methyl]benzoic acid |
|---|---|
| PubChem CID | 167507029 |
| Molecular Formula | C19H16Cl2N2O3 |
| Molecular Weight | 391.25 g/mol |
| Exact Mass | 390.05 |
| IUPAC Name | 4-[[1-(2,4-dichlorophenyl)-2-imidazol-1-ylethoxy]methyl]benzoic acid |
| SMILES | O=C(O)c1ccc(COC(Cn2ccnc2)c2ccc(Cl)cc2Cl)cc1 |
| InChI | InChI=1S/C19H16Cl2N2O3/c20-15-5-6-16(17(21)9-15)18(10-23-8-7-22-12-23)26-11-13-1-3-14(4-2-13)19(24)25/h1-9,12,18H,10-11H2,(H,24,25) |
| InChIKey | SGWWHTBGWRYYKQ-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.25 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |