C18H10Cl5N3S — CID 21402312
4-[2-imidazol-1-yl-1-(2,3,4,5,6-pentachlorophenyl)sulfanylethyl]benzonitrile (PubChem CID 21402312) has the molecular formula C18H10Cl5N3S and a molecular weight of 477.63 g/mol. Its IUPAC name is 4-[2-imidazol-1-yl-1-(2,3,4,5,6-pentachlorophenyl)sulfanylethyl]benzonitrile.
| Compound Name | 4-[2-imidazol-1-yl-1-(2,3,4,5,6-pentachlorophenyl)sulfanylethyl]benzonitrile |
|---|---|
| PubChem CID | 21402312 |
| Molecular Formula | C18H10Cl5N3S |
| Molecular Weight | 477.63 g/mol |
| Exact Mass | 474.90 |
| IUPAC Name | 4-[2-imidazol-1-yl-1-(2,3,4,5,6-pentachlorophenyl)sulfanylethyl]benzonitrile |
| SMILES | N#Cc1ccc(C(Cn2ccnc2)Sc2c(Cl)c(Cl)c(Cl)c(Cl)c2Cl)cc1 |
| InChI | InChI=1S/C18H10Cl5N3S/c19-13-14(20)16(22)18(17(23)15(13)21)27-12(8-26-6-5-25-9-26)11-3-1-10(7-24)2-4-11/h1-6,9,12H,8H2 |
| InChIKey | MYRVSDJFZPTADC-UHFFFAOYSA-N |
| XLogP | 7.56 |
| TPSA | 41.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.63 |
| LogP ≤ 5 | 7.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|