C18H15Cl2N3O2S — CID 21402271
1-[2-[(3,4-dichlorophenyl)methylsulfanyl]-2-(4-nitrophenyl)ethyl]imidazole (PubChem CID 21402271) has the molecular formula C18H15Cl2N3O2S and a molecular weight of 408.31 g/mol. Its IUPAC name is 1-[2-[(3,4-dichlorophenyl)methylsulfanyl]-2-(4-nitrophenyl)ethyl]imidazole.
| Compound Name | 1-[2-[(3,4-dichlorophenyl)methylsulfanyl]-2-(4-nitrophenyl)ethyl]imidazole |
|---|---|
| PubChem CID | 21402271 |
| Molecular Formula | C18H15Cl2N3O2S |
| Molecular Weight | 408.31 g/mol |
| Exact Mass | 407.03 |
| IUPAC Name | 1-[2-[(3,4-dichlorophenyl)methylsulfanyl]-2-(4-nitrophenyl)ethyl]imidazole |
| SMILES | O=[N+]([O-])c1ccc(C(Cn2ccnc2)SCc2ccc(Cl)c(Cl)c2)cc1 |
| InChI | InChI=1S/C18H15Cl2N3O2S/c19-16-6-1-13(9-17(16)20)11-26-18(10-22-8-7-21-12-22)14-2-4-15(5-3-14)23(24)25/h1-9,12,18H,10-11H2 |
| InChIKey | NIUXIACVTBURCI-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 60.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.31 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|