C18H14Cl5N3O3S2 — CID 21423712
nitric acid;1-[3-(2,3,4,5,6-pentachlorophenyl)sulfanyl-2-phenylsulfanylpropyl]imidazole (PubChem CID 21423712) has the molecular formula C18H14Cl5N3O3S2 and a molecular weight of 561.73 g/mol. Its IUPAC name is nitric acid;1-[3-(2,3,4,5,6-pentachlorophenyl)sulfanyl-2-phenylsulfanylpropyl]imidazole.
| Compound Name | nitric acid;1-[3-(2,3,4,5,6-pentachlorophenyl)sulfanyl-2-phenylsulfanylpropyl]imidazole |
|---|---|
| PubChem CID | 21423712 |
| Molecular Formula | C18H14Cl5N3O3S2 |
| Molecular Weight | 561.73 g/mol |
| Exact Mass | 558.89 |
| IUPAC Name | nitric acid;1-[3-(2,3,4,5,6-pentachlorophenyl)sulfanyl-2-phenylsulfanylpropyl]imidazole |
| SMILES | Clc1c(Cl)c(Cl)c(SCC(Cn2ccnc2)Sc2ccccc2)c(Cl)c1Cl.O=[N+]([O-])O |
| InChI | InChI=1S/C18H13Cl5N2S2.HNO3/c19-13-14(20)16(22)18(17(23)15(13)21)26-9-12(8-25-7-6-24-10-25)27-11-4-2-1-3-5-11;2-1(3)4/h1-7,10,12H,8-9H2;(H,2,3,4) |
| InChIKey | NRPSYBPXKXCITJ-UHFFFAOYSA-N |
| XLogP | 7.76 |
| TPSA | 81.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.73 |
| LogP ≤ 5 | 7.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|