C19H15Cl3N2OS — CID 88823868
S-[2-chloro-1-(4-chlorophenyl)-2-imidazol-1-ylethyl] 2-(4-chlorophenyl)ethanethioate (PubChem CID 88823868) has the molecular formula C19H15Cl3N2OS and a molecular weight of 425.77 g/mol. Its IUPAC name is S-[2-chloro-1-(4-chlorophenyl)-2-imidazol-1-ylethyl] 2-(4-chlorophenyl)ethanethioate.
| Compound Name | S-[2-chloro-1-(4-chlorophenyl)-2-imidazol-1-ylethyl] 2-(4-chlorophenyl)ethanethioate |
|---|---|
| PubChem CID | 88823868 |
| Molecular Formula | C19H15Cl3N2OS |
| Molecular Weight | 425.77 g/mol |
| Exact Mass | 424.00 |
| IUPAC Name | S-[2-chloro-1-(4-chlorophenyl)-2-imidazol-1-ylethyl] 2-(4-chlorophenyl)ethanethioate |
| SMILES | O=C(Cc1ccc(Cl)cc1)SC(c1ccc(Cl)cc1)C(Cl)n1ccnc1 |
| InChI | InChI=1S/C19H15Cl3N2OS/c20-15-5-1-13(2-6-15)11-17(25)26-18(14-3-7-16(21)8-4-14)19(22)24-10-9-23-12-24/h1-10,12,18-19H,11H2 |
| InChIKey | PIJPSOBFXBRJHC-UHFFFAOYSA-N |
| XLogP | 6.17 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.77 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|