C20H18Cl2N2OS2 — CID 88824618
O-[(4-methylphenyl)methyl] [2-chloro-1-(4-chlorophenyl)-2-imidazol-1-ylethyl]sulfanylmethanethioate (PubChem CID 88824618) has the molecular formula C20H18Cl2N2OS2 and a molecular weight of 437.42 g/mol. Its IUPAC name is O-[(4-methylphenyl)methyl] [2-chloro-1-(4-chlorophenyl)-2-imidazol-1-ylethyl]sulfanylmethanethioate.
| Compound Name | O-[(4-methylphenyl)methyl] [2-chloro-1-(4-chlorophenyl)-2-imidazol-1-ylethyl]sulfanylmethanethioate |
|---|---|
| PubChem CID | 88824618 |
| Molecular Formula | C20H18Cl2N2OS2 |
| Molecular Weight | 437.42 g/mol |
| Exact Mass | 436.02 |
| IUPAC Name | O-[(4-methylphenyl)methyl] [2-chloro-1-(4-chlorophenyl)-2-imidazol-1-ylethyl]sulfanylmethanethioate |
| SMILES | Cc1ccc(COC(=S)SC(c2ccc(Cl)cc2)C(Cl)n2ccnc2)cc1 |
| InChI | InChI=1S/C20H18Cl2N2OS2/c1-14-2-4-15(5-3-14)12-25-20(26)27-18(16-6-8-17(21)9-7-16)19(22)24-11-10-23-13-24/h2-11,13,18-19H,12H2,1H3 |
| InChIKey | ANEDEHQMFKQYQZ-UHFFFAOYSA-N |
| XLogP | 6.56 |
| TPSA | 27.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.42 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|