C19H16Cl2N2S2 — CID 88825112
[2-chloro-1-(4-chlorophenyl)-2-imidazol-1-ylethyl] 2-phenylethanedithioate (PubChem CID 88825112) has the molecular formula C19H16Cl2N2S2 and a molecular weight of 407.39 g/mol. Its IUPAC name is [2-chloro-1-(4-chlorophenyl)-2-imidazol-1-ylethyl] 2-phenylethanedithioate.
| Compound Name | [2-chloro-1-(4-chlorophenyl)-2-imidazol-1-ylethyl] 2-phenylethanedithioate |
|---|---|
| PubChem CID | 88825112 |
| Molecular Formula | C19H16Cl2N2S2 |
| Molecular Weight | 407.39 g/mol |
| Exact Mass | 406.01 |
| IUPAC Name | [2-chloro-1-(4-chlorophenyl)-2-imidazol-1-ylethyl] 2-phenylethanedithioate |
| SMILES | S=C(Cc1ccccc1)SC(c1ccc(Cl)cc1)C(Cl)n1ccnc1 |
| InChI | InChI=1S/C19H16Cl2N2S2/c20-16-8-6-15(7-9-16)18(19(21)23-11-10-22-13-23)25-17(24)12-14-4-2-1-3-5-14/h1-11,13,18-19H,12H2 |
| InChIKey | ZYPSXLFULISOSU-UHFFFAOYSA-N |
| XLogP | 6.32 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.39 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|