C16H19Cl2N3O3S2 — CID 88824801
[2-chloro-1-(4-chlorophenyl)-2-imidazol-1-ylethyl] pentanedithioate;nitric acid (PubChem CID 88824801) has the molecular formula C16H19Cl2N3O3S2 and a molecular weight of 436.39 g/mol. Its IUPAC name is [2-chloro-1-(4-chlorophenyl)-2-imidazol-1-ylethyl] pentanedithioate;nitric acid.
| Compound Name | [2-chloro-1-(4-chlorophenyl)-2-imidazol-1-ylethyl] pentanedithioate;nitric acid |
|---|---|
| PubChem CID | 88824801 |
| Molecular Formula | C16H19Cl2N3O3S2 |
| Molecular Weight | 436.39 g/mol |
| Exact Mass | 435.02 |
| IUPAC Name | [2-chloro-1-(4-chlorophenyl)-2-imidazol-1-ylethyl] pentanedithioate;nitric acid |
| SMILES | CCCCC(=S)SC(c1ccc(Cl)cc1)C(Cl)n1ccnc1.O=[N+]([O-])O |
| InChI | InChI=1S/C16H18Cl2N2S2.HNO3/c1-2-3-4-14(21)22-15(12-5-7-13(17)8-6-12)16(18)20-10-9-19-11-20;2-1(3)4/h5-11,15-16H,2-4H2,1H3;(H,2,3,4) |
| InChIKey | NUDPDNDVRXXTQO-UHFFFAOYSA-N |
| XLogP | 5.92 |
| TPSA | 81.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.39 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|