C18H22Cl2N2OS2 — CID 88824541
O-hexyl [2-chloro-1-(4-chlorophenyl)-2-imidazol-1-ylethyl]sulfanylmethanethioate (PubChem CID 88824541) has the molecular formula C18H22Cl2N2OS2 and a molecular weight of 417.43 g/mol. Its IUPAC name is O-hexyl [2-chloro-1-(4-chlorophenyl)-2-imidazol-1-ylethyl]sulfanylmethanethioate.
| Compound Name | O-hexyl [2-chloro-1-(4-chlorophenyl)-2-imidazol-1-ylethyl]sulfanylmethanethioate |
|---|---|
| PubChem CID | 88824541 |
| Molecular Formula | C18H22Cl2N2OS2 |
| Molecular Weight | 417.43 g/mol |
| Exact Mass | 416.06 |
| IUPAC Name | O-hexyl [2-chloro-1-(4-chlorophenyl)-2-imidazol-1-ylethyl]sulfanylmethanethioate |
| SMILES | CCCCCCOC(=S)SC(c1ccc(Cl)cc1)C(Cl)n1ccnc1 |
| InChI | InChI=1S/C18H22Cl2N2OS2/c1-2-3-4-5-12-23-18(24)25-16(14-6-8-15(19)9-7-14)17(20)22-11-10-21-13-22/h6-11,13,16-17H,2-5,12H2,1H3 |
| InChIKey | VNJWYHUNJABYNJ-UHFFFAOYSA-N |
| XLogP | 6.63 |
| TPSA | 27.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.43 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|