C17H21Cl3N2OS — CID 54303602
1-[3-butylsulfanyl-2-[(2,4,5-trichlorophenyl)methoxy]propyl]imidazole (PubChem CID 54303602) has the molecular formula C17H21Cl3N2OS and a molecular weight of 407.79 g/mol. Its IUPAC name is 1-[3-butylsulfanyl-2-[(2,4,5-trichlorophenyl)methoxy]propyl]imidazole.
| Compound Name | 1-[3-butylsulfanyl-2-[(2,4,5-trichlorophenyl)methoxy]propyl]imidazole |
|---|---|
| PubChem CID | 54303602 |
| Molecular Formula | C17H21Cl3N2OS |
| Molecular Weight | 407.79 g/mol |
| Exact Mass | 406.04 |
| IUPAC Name | 1-[3-butylsulfanyl-2-[(2,4,5-trichlorophenyl)methoxy]propyl]imidazole |
| SMILES | CCCCSCC(Cn1ccnc1)OCc1cc(Cl)c(Cl)cc1Cl |
| InChI | InChI=1S/C17H21Cl3N2OS/c1-2-3-6-24-11-14(9-22-5-4-21-12-22)23-10-13-7-16(19)17(20)8-15(13)18/h4-5,7-8,12,14H,2-3,6,9-11H2,1H3 |
| InChIKey | SFXVPKYAEOFSDA-UHFFFAOYSA-N |
| XLogP | 5.96 |
| TPSA | 27.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.79 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|