C18H18Cl2N2O3 — CID 166236019
[1-(2,4-dichlorophenyl)-2-imidazol-1-ylethyl] (2S,3R)-2-ethenyloxolane-3-carboxylate (PubChem CID 166236019) has the molecular formula C18H18Cl2N2O3 and a molecular weight of 381.26 g/mol. Its IUPAC name is [1-(2,4-dichlorophenyl)-2-imidazol-1-ylethyl] (2S,3R)-2-ethenyloxolane-3-carboxylate.
| Compound Name | [1-(2,4-dichlorophenyl)-2-imidazol-1-ylethyl] (2S,3R)-2-ethenyloxolane-3-carboxylate |
|---|---|
| PubChem CID | 166236019 |
| Molecular Formula | C18H18Cl2N2O3 |
| Molecular Weight | 381.26 g/mol |
| Exact Mass | 380.07 |
| IUPAC Name | [1-(2,4-dichlorophenyl)-2-imidazol-1-ylethyl] (2S,3R)-2-ethenyloxolane-3-carboxylate |
| SMILES | C=C[C@@H]1OCC[C@H]1C(=O)OC(Cn1ccnc1)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C18H18Cl2N2O3/c1-2-16-14(5-8-24-16)18(23)25-17(10-22-7-6-21-11-22)13-4-3-12(19)9-15(13)20/h2-4,6-7,9,11,14,16-17H,1,5,8,10H2/t14-,16+,17?/m1/s1 |
| InChIKey | TUZAIBAGRSDZSF-UMFITKPXSA-N |
| XLogP | 4.07 |
| TPSA | 53.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.26 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|