C11H9Cl2N5 — CID 154613010
1-[2-azido-2-deuterio-2-(2,4-dichlorophenyl)ethyl]imidazole (PubChem CID 154613010) has the molecular formula C11H9Cl2N5 and a molecular weight of 283.14 g/mol. Its IUPAC name is 1-[2-azido-2-deuterio-2-(2,4-dichlorophenyl)ethyl]imidazole.
| Compound Name | 1-[2-azido-2-deuterio-2-(2,4-dichlorophenyl)ethyl]imidazole |
|---|---|
| PubChem CID | 154613010 |
| Molecular Formula | C11H9Cl2N5 |
| Molecular Weight | 283.14 g/mol |
| Exact Mass | 282.03 |
| IUPAC Name | 1-[2-azido-2-deuterio-2-(2,4-dichlorophenyl)ethyl]imidazole |
| SMILES | [2H]C(Cn1ccnc1)(N=[N+]=[N-])c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C11H9Cl2N5/c12-8-1-2-9(10(13)5-8)11(16-17-14)6-18-4-3-15-7-18/h1-5,7,11H,6H2/i11D |
| InChIKey | ZYOZOFLDVWJMLO-WORMITQPSA-N |
| XLogP | 4.24 |
| TPSA | 66.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.14 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|