C23H26N2O2 — CID 155185662
1-[(Z)-1-(2,4-dimethylphenyl)-1-[2-(4-methylphenoxy)ethoxy]prop-1-en-2-yl]imidazole (PubChem CID 155185662) has the molecular formula C23H26N2O2 and a molecular weight of 362.47 g/mol. Its IUPAC name is 1-[(Z)-1-(2,4-dimethylphenyl)-1-[2-(4-methylphenoxy)ethoxy]prop-1-en-2-yl]imidazole.
| Compound Name | 1-[(Z)-1-(2,4-dimethylphenyl)-1-[2-(4-methylphenoxy)ethoxy]prop-1-en-2-yl]imidazole |
|---|---|
| PubChem CID | 155185662 |
| Molecular Formula | C23H26N2O2 |
| Molecular Weight | 362.47 g/mol |
| Exact Mass | 362.20 |
| IUPAC Name | 1-[(Z)-1-(2,4-dimethylphenyl)-1-[2-(4-methylphenoxy)ethoxy]prop-1-en-2-yl]imidazole |
| SMILES | C/C(=C(/OCCOc1ccc(C)cc1)c1ccc(C)cc1C)n1ccnc1 |
| InChI | InChI=1S/C23H26N2O2/c1-17-5-8-21(9-6-17)26-13-14-27-23(20(4)25-12-11-24-16-25)22-10-7-18(2)15-19(22)3/h5-12,15-16H,13-14H2,1-4H3/b23-20- |
| InChIKey | JMVNILMBDIEEOE-ATJXCDBQSA-N |
| XLogP | 5.25 |
| TPSA | 36.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.47 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|