C29H28BrCl4N3O4 — CID 88823855
1-[(2-butoxy-4-nitrophenyl)methyl]-3-[2-(2,4-dichlorophenyl)-2-[(2,4-dichlorophenyl)methoxy]ethyl]imidazol-1-ium bromide (PubChem CID 88823855) has the molecular formula C29H28BrCl4N3O4 and a molecular weight of 704.28 g/mol. Its IUPAC name is 1-[(2-butoxy-4-nitrophenyl)methyl]-3-[2-(2,4-dichlorophenyl)-2-[(2,4-dichlorophenyl)methoxy]ethyl]imidazol-1-ium bromide.
| Compound Name | 1-[(2-butoxy-4-nitrophenyl)methyl]-3-[2-(2,4-dichlorophenyl)-2-[(2,4-dichlorophenyl)methoxy]ethyl]imidazol-1-ium bromide |
|---|---|
| PubChem CID | 88823855 |
| Molecular Formula | C29H28BrCl4N3O4 |
| Molecular Weight | 704.28 g/mol |
| Exact Mass | 701.00 |
| IUPAC Name | 1-[(2-butoxy-4-nitrophenyl)methyl]-3-[2-(2,4-dichlorophenyl)-2-[(2,4-dichlorophenyl)methoxy]ethyl]imidazol-1-ium bromide |
| SMILES | CCCCOc1cc([N+](=O)[O-])ccc1C[n+]1ccn(CC(OCc2ccc(Cl)cc2Cl)c2ccc(Cl)cc2Cl)c1.[Br-] |
| InChI | InChI=1S/C29H28Cl4N3O4.BrH/c1-2-3-12-39-28-15-24(36(37)38)8-5-20(28)16-34-10-11-35(19-34)17-29(25-9-7-23(31)14-27(25)33)40-18-21-4-6-22(30)13-26(21)32;/h4-11,13-15,19,29H,2-3,12,16-18H2,1H3;1H/q+1;/p-1 |
| InChIKey | JHANLGHQYRZILJ-UHFFFAOYSA-M |
| XLogP | 5.49 |
| TPSA | 70.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 704.28 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|