C27H24Cl4IN3O4 — CID 86734653
1-[2-(2,4-dichlorophenyl)-2-[(2,4-dichlorophenyl)methoxy]ethyl]-3-[(2-ethoxy-5-nitrophenyl)methyl]imidazol-3-ium iodide (PubChem CID 86734653) has the molecular formula C27H24Cl4IN3O4 and a molecular weight of 723.22 g/mol. Its IUPAC name is 1-[2-(2,4-dichlorophenyl)-2-[(2,4-dichlorophenyl)methoxy]ethyl]-3-[(2-ethoxy-5-nitrophenyl)methyl]imidazol-3-ium iodide.
| Compound Name | 1-[2-(2,4-dichlorophenyl)-2-[(2,4-dichlorophenyl)methoxy]ethyl]-3-[(2-ethoxy-5-nitrophenyl)methyl]imidazol-3-ium iodide |
|---|---|
| PubChem CID | 86734653 |
| Molecular Formula | C27H24Cl4IN3O4 |
| Molecular Weight | 723.22 g/mol |
| Exact Mass | 720.96 |
| IUPAC Name | 1-[2-(2,4-dichlorophenyl)-2-[(2,4-dichlorophenyl)methoxy]ethyl]-3-[(2-ethoxy-5-nitrophenyl)methyl]imidazol-3-ium iodide |
| SMILES | CCOc1ccc([N+](=O)[O-])cc1C[n+]1ccn(CC(OCc2ccc(Cl)cc2Cl)c2ccc(Cl)cc2Cl)c1.[I-] |
| InChI | InChI=1S/C27H24Cl4N3O4.HI/c1-2-37-26-8-6-22(34(35)36)11-19(26)14-32-9-10-33(17-32)15-27(23-7-5-21(29)13-25(23)31)38-16-18-3-4-20(28)12-24(18)30;/h3-13,17,27H,2,14-16H2,1H3;1H/q+1;/p-1 |
| InChIKey | DRYPUHHOLPRGKY-UHFFFAOYSA-M |
| XLogP | 4.71 |
| TPSA | 70.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 723.22 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|