C25H23Cl3N3O3S+ — CID 54006229
4-[[3-[2-[(4-chlorophenyl)methoxy]-2-(2,4-dichlorophenyl)ethyl]imidazol-1-ium-1-yl]methyl]benzenesulfonamide (PubChem CID 54006229) has the molecular formula C25H23Cl3N3O3S+ and a molecular weight of 551.90 g/mol. Its IUPAC name is 4-[[3-[2-[(4-chlorophenyl)methoxy]-2-(2,4-dichlorophenyl)ethyl]imidazol-1-ium-1-yl]methyl]benzenesulfonamide.
| Compound Name | 4-[[3-[2-[(4-chlorophenyl)methoxy]-2-(2,4-dichlorophenyl)ethyl]imidazol-1-ium-1-yl]methyl]benzenesulfonamide |
|---|---|
| PubChem CID | 54006229 |
| Molecular Formula | C25H23Cl3N3O3S+ |
| Molecular Weight | 551.90 g/mol |
| Exact Mass | 550.05 |
| IUPAC Name | 4-[[3-[2-[(4-chlorophenyl)methoxy]-2-(2,4-dichlorophenyl)ethyl]imidazol-1-ium-1-yl]methyl]benzenesulfonamide |
| SMILES | NS(=O)(=O)c1ccc(C[n+]2ccn(CC(OCc3ccc(Cl)cc3)c3ccc(Cl)cc3Cl)c2)cc1 |
| InChI | InChI=1S/C25H23Cl3N3O3S/c26-20-5-1-19(2-6-20)16-34-25(23-10-7-21(27)13-24(23)28)15-31-12-11-30(17-31)14-18-3-8-22(9-4-18)35(29,32)33/h1-13,17,25H,14-16H2,(H2,29,32,33)/q+1 |
| InChIKey | KPBMMPCICWFGST-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 78.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.90 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|