C26H21Cl4FN3O2+ — CID 21443340
2-[3-[2-(2,4-dichlorophenyl)-2-[(2,4-dichlorophenyl)methoxy]ethyl]imidazol-1-ium-1-yl]-N-(4-fluorophenyl)acetamide (PubChem CID 21443340) has the molecular formula C26H21Cl4FN3O2+ and a molecular weight of 568.28 g/mol. Its IUPAC name is 2-[3-[2-(2,4-dichlorophenyl)-2-[(2,4-dichlorophenyl)methoxy]ethyl]imidazol-1-ium-1-yl]-N-(4-fluorophenyl)acetamide.
| Compound Name | 2-[3-[2-(2,4-dichlorophenyl)-2-[(2,4-dichlorophenyl)methoxy]ethyl]imidazol-1-ium-1-yl]-N-(4-fluorophenyl)acetamide |
|---|---|
| PubChem CID | 21443340 |
| Molecular Formula | C26H21Cl4FN3O2+ |
| Molecular Weight | 568.28 g/mol |
| Exact Mass | 566.04 |
| IUPAC Name | 2-[3-[2-(2,4-dichlorophenyl)-2-[(2,4-dichlorophenyl)methoxy]ethyl]imidazol-1-ium-1-yl]-N-(4-fluorophenyl)acetamide |
| SMILES | O=C(C[n+]1ccn(CC(OCc2ccc(Cl)cc2Cl)c2ccc(Cl)cc2Cl)c1)Nc1ccc(F)cc1 |
| InChI | InChI=1S/C26H20Cl4FN3O2/c27-18-2-1-17(23(29)11-18)15-36-25(22-8-3-19(28)12-24(22)30)13-33-9-10-34(16-33)14-26(35)32-21-6-4-20(31)5-7-21/h1-12,16,25H,13-15H2/p+1 |
| InChIKey | UUFHZHKKDSPARU-UHFFFAOYSA-O |
| XLogP | 7.13 |
| TPSA | 47.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.28 |
| LogP ≤ 5 | 7.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|