C27H25Cl4N3O2 — CID 88824482
N-benzyl-2-[3-[2-[(4-chlorophenyl)methoxy]-2-(2,4-dichlorophenyl)ethyl]imidazol-1-ium-1-yl]acetamide chloride (PubChem CID 88824482) has the molecular formula C27H25Cl4N3O2 and a molecular weight of 565.33 g/mol. Its IUPAC name is N-benzyl-2-[3-[2-[(4-chlorophenyl)methoxy]-2-(2,4-dichlorophenyl)ethyl]imidazol-1-ium-1-yl]acetamide chloride.
| Compound Name | N-benzyl-2-[3-[2-[(4-chlorophenyl)methoxy]-2-(2,4-dichlorophenyl)ethyl]imidazol-1-ium-1-yl]acetamide chloride |
|---|---|
| PubChem CID | 88824482 |
| Molecular Formula | C27H25Cl4N3O2 |
| Molecular Weight | 565.33 g/mol |
| Exact Mass | 563.07 |
| IUPAC Name | N-benzyl-2-[3-[2-[(4-chlorophenyl)methoxy]-2-(2,4-dichlorophenyl)ethyl]imidazol-1-ium-1-yl]acetamide chloride |
| SMILES | O=C(C[n+]1ccn(CC(OCc2ccc(Cl)cc2)c2ccc(Cl)cc2Cl)c1)NCc1ccccc1.[Cl-] |
| InChI | InChI=1S/C27H24Cl3N3O2.ClH/c28-22-8-6-21(7-9-22)18-35-26(24-11-10-23(29)14-25(24)30)16-32-12-13-33(19-32)17-27(34)31-15-20-4-2-1-3-5-20;/h1-14,19,26H,15-18H2;1H |
| InChIKey | ORNQKXMKFBXFEH-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 47.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.33 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|