C26H20Cl6N2O6S — CID 173456165
1-(2,4-dichlorophenyl)-2-[3-[2-(2,4-dichlorophenyl)-2-[(2,4-dichlorophenyl)methoxy]ethyl]imidazol-1-ium-1-yl]ethanone;hydrogen sulfate (PubChem CID 173456165) has the molecular formula C26H20Cl6N2O6S and a molecular weight of 701.24 g/mol. Its IUPAC name is 1-(2,4-dichlorophenyl)-2-[3-[2-(2,4-dichlorophenyl)-2-[(2,4-dichlorophenyl)methoxy]ethyl]imidazol-1-ium-1-yl]ethanone;hydrogen sulfate.
| Compound Name | 1-(2,4-dichlorophenyl)-2-[3-[2-(2,4-dichlorophenyl)-2-[(2,4-dichlorophenyl)methoxy]ethyl]imidazol-1-ium-1-yl]ethanone;hydrogen sulfate |
|---|---|
| PubChem CID | 173456165 |
| Molecular Formula | C26H20Cl6N2O6S |
| Molecular Weight | 701.24 g/mol |
| Exact Mass | 697.92 |
| IUPAC Name | 1-(2,4-dichlorophenyl)-2-[3-[2-(2,4-dichlorophenyl)-2-[(2,4-dichlorophenyl)methoxy]ethyl]imidazol-1-ium-1-yl]ethanone;hydrogen sulfate |
| SMILES | O=C(C[n+]1ccn(CC(OCc2ccc(Cl)cc2Cl)c2ccc(Cl)cc2Cl)c1)c1ccc(Cl)cc1Cl.O=S(=O)([O-])O |
| InChI | InChI=1S/C26H19Cl6N2O2.H2O4S/c27-17-2-1-16(22(30)9-17)14-36-26(21-6-4-19(29)11-24(21)32)13-34-8-7-33(15-34)12-25(35)20-5-3-18(28)10-23(20)31;1-5(2,3)4/h1-11,15,26H,12-14H2;(H2,1,2,3,4)/q+1;/p-1 |
| InChIKey | BBHNQSJSRPXNIY-UHFFFAOYSA-M |
| XLogP | 7.54 |
| TPSA | 112.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 701.24 |
| LogP ≤ 5 | 7.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|