C13H14Cl2N2O — CID 63977323
2-(2,4-dichlorophenyl)-1-(1-ethylimidazol-2-yl)ethanol (PubChem CID 63977323) has the molecular formula C13H14Cl2N2O and a molecular weight of 285.17 g/mol. Its IUPAC name is 2-(2,4-dichlorophenyl)-1-(1-ethylimidazol-2-yl)ethanol.
| Compound Name | 2-(2,4-dichlorophenyl)-1-(1-ethylimidazol-2-yl)ethanol |
|---|---|
| PubChem CID | 63977323 |
| Molecular Formula | C13H14Cl2N2O |
| Molecular Weight | 285.17 g/mol |
| Exact Mass | 284.05 |
| IUPAC Name | 2-(2,4-dichlorophenyl)-1-(1-ethylimidazol-2-yl)ethanol |
| SMILES | CCn1ccnc1C(O)Cc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C13H14Cl2N2O/c1-2-17-6-5-16-13(17)12(18)7-9-3-4-10(14)8-11(9)15/h3-6,8,12,18H,2,7H2,1H3 |
| InChIKey | ABJIINITPHZKAC-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.17 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |