C13H13Cl2N3O3S — CID 71618707
1-[2-(2,4-dichlorophenyl)-2-methylsulfanylethyl]-2-methoxy-4-nitroimidazole (PubChem CID 71618707) has the molecular formula C13H13Cl2N3O3S and a molecular weight of 362.24 g/mol. Its IUPAC name is 1-[2-(2,4-dichlorophenyl)-2-methylsulfanylethyl]-2-methoxy-4-nitroimidazole.
| Compound Name | 1-[2-(2,4-dichlorophenyl)-2-methylsulfanylethyl]-2-methoxy-4-nitroimidazole |
|---|---|
| PubChem CID | 71618707 |
| Molecular Formula | C13H13Cl2N3O3S |
| Molecular Weight | 362.24 g/mol |
| Exact Mass | 361.01 |
| IUPAC Name | 1-[2-(2,4-dichlorophenyl)-2-methylsulfanylethyl]-2-methoxy-4-nitroimidazole |
| SMILES | COc1nc([N+](=O)[O-])cn1CC(SC)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C13H13Cl2N3O3S/c1-21-13-16-12(18(19)20)7-17(13)6-11(22-2)9-4-3-8(14)5-10(9)15/h3-5,7,11H,6H2,1-2H3 |
| InChIKey | YEGOPXXPBINWQN-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 70.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.24 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|