C15H13Cl2NO5 — CID 3743169
(2,4-dichlorophenyl)-(4,5-dimethoxy-2-nitrophenyl)methanol (PubChem CID 3743169) has the molecular formula C15H13Cl2NO5 and a molecular weight of 358.18 g/mol. Its IUPAC name is (2,4-dichlorophenyl)-(4,5-dimethoxy-2-nitrophenyl)methanol.
| Compound Name | (2,4-dichlorophenyl)-(4,5-dimethoxy-2-nitrophenyl)methanol |
|---|---|
| PubChem CID | 3743169 |
| Molecular Formula | C15H13Cl2NO5 |
| Molecular Weight | 358.18 g/mol |
| Exact Mass | 357.02 |
| IUPAC Name | (2,4-dichlorophenyl)-(4,5-dimethoxy-2-nitrophenyl)methanol |
| SMILES | COc1cc(C(O)c2ccc(Cl)cc2Cl)c([N+](=O)[O-])cc1OC |
| InChI | InChI=1S/C15H13Cl2NO5/c1-22-13-6-10(12(18(20)21)7-14(13)23-2)15(19)9-4-3-8(16)5-11(9)17/h3-7,15,19H,1-2H3 |
| InChIKey | SNQKAHZPWQYRCM-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 81.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.18 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|