C13H8BrCl2NO2 — CID 114760562
3-bromo-1-[2-(2,4-dichlorophenyl)-2-oxoethyl]pyridin-2-one (PubChem CID 114760562) has the molecular formula C13H8BrCl2NO2 and a molecular weight of 361.02 g/mol. Its IUPAC name is 3-bromo-1-[2-(2,4-dichlorophenyl)-2-oxoethyl]pyridin-2-one.
| Compound Name | 3-bromo-1-[2-(2,4-dichlorophenyl)-2-oxoethyl]pyridin-2-one |
|---|---|
| PubChem CID | 114760562 |
| Molecular Formula | C13H8BrCl2NO2 |
| Molecular Weight | 361.02 g/mol |
| Exact Mass | 358.91 |
| IUPAC Name | 3-bromo-1-[2-(2,4-dichlorophenyl)-2-oxoethyl]pyridin-2-one |
| SMILES | O=C(Cn1cccc(Br)c1=O)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C13H8BrCl2NO2/c14-10-2-1-5-17(13(10)19)7-12(18)9-4-3-8(15)6-11(9)16/h1-6H,7H2 |
| InChIKey | KJWWUDJDGXSPFX-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 39.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.02 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |