C33H34ClF3N4O7 — CID 70874449
(2R)-4-(2-chloro-4-nitroimidazol-1-yl)-1-[4-[4-[[4-[[4-(trifluoromethoxy)phenyl]methoxy]phenoxy]methyl]piperidin-1-yl]phenoxy]butan-2-ol (PubChem CID 70874449) has the molecular formula C33H34ClF3N4O7 and a molecular weight of 691.10 g/mol. Its IUPAC name is (2R)-4-(2-chloro-4-nitroimidazol-1-yl)-1-[4-[4-[[4-[[4-(trifluoromethoxy)phenyl]methoxy]phenoxy]methyl]piperidin-1-yl]phenoxy]butan-2-ol.
| Compound Name | (2R)-4-(2-chloro-4-nitroimidazol-1-yl)-1-[4-[4-[[4-[[4-(trifluoromethoxy)phenyl]methoxy]phenoxy]methyl]piperidin-1-yl]phenoxy]butan-2-ol |
|---|---|
| PubChem CID | 70874449 |
| Molecular Formula | C33H34ClF3N4O7 |
| Molecular Weight | 691.10 g/mol |
| Exact Mass | 690.21 |
| IUPAC Name | (2R)-4-(2-chloro-4-nitroimidazol-1-yl)-1-[4-[4-[[4-[[4-(trifluoromethoxy)phenyl]methoxy]phenoxy]methyl]piperidin-1-yl]phenoxy]butan-2-ol |
| SMILES | O=[N+]([O-])c1cn(CC[C@@H](O)COc2ccc(N3CCC(COc4ccc(OCc5ccc(OC(F)(F)F)cc5)cc4)CC3)cc2)c(Cl)n1 |
| InChI | InChI=1S/C33H34ClF3N4O7/c34-32-38-31(41(43)44)19-40(32)18-15-26(42)22-47-27-7-3-25(4-8-27)39-16-13-24(14-17-39)21-46-29-11-9-28(10-12-29)45-20-23-1-5-30(6-2-23)48-33(35,36)37/h1-12,19,24,26,42H,13-18,20-22H2/t26-/m1/s1 |
| InChIKey | PKPIQENOPDBHDZ-AREMUKBSSA-N |
| XLogP | 7.05 |
| TPSA | 121.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 691.10 |
| LogP ≤ 5 | 7.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|