C25H31ClN6O6 — CID 70874463
tert-butyl 4-[6-[(2R)-4-(2-chloro-4-nitroimidazol-1-yl)-2-hydroxybutoxy]quinolin-2-yl]piperazine-1-carboxylate (PubChem CID 70874463) has the molecular formula C25H31ClN6O6 and a molecular weight of 547.01 g/mol. Its IUPAC name is tert-butyl 4-[6-[(2R)-4-(2-chloro-4-nitroimidazol-1-yl)-2-hydroxybutoxy]quinolin-2-yl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[6-[(2R)-4-(2-chloro-4-nitroimidazol-1-yl)-2-hydroxybutoxy]quinolin-2-yl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 70874463 |
| Molecular Formula | C25H31ClN6O6 |
| Molecular Weight | 547.01 g/mol |
| Exact Mass | 546.20 |
| IUPAC Name | tert-butyl 4-[6-[(2R)-4-(2-chloro-4-nitroimidazol-1-yl)-2-hydroxybutoxy]quinolin-2-yl]piperazine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCN(c2ccc3cc(OC[C@H](O)CCn4cc([N+](=O)[O-])nc4Cl)ccc3n2)CC1 |
| InChI | InChI=1S/C25H31ClN6O6/c1-25(2,3)38-24(34)30-12-10-29(11-13-30)21-7-4-17-14-19(5-6-20(17)27-21)37-16-18(33)8-9-31-15-22(32(35)36)28-23(31)26/h4-7,14-15,18,33H,8-13,16H2,1-3H3/t18-/m1/s1 |
| InChIKey | AMVZREXJOJKZCK-GOSISDBHSA-N |
| XLogP | 3.88 |
| TPSA | 136.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.01 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|