C14H16ClN3O6S — CID 86709368
[(2R)-4-(2-chloro-4-nitroimidazol-1-yl)-2-hydroxybutyl] 4-methylbenzenesulfonate (PubChem CID 86709368) has the molecular formula C14H16ClN3O6S and a molecular weight of 389.82 g/mol. Its IUPAC name is [(2R)-4-(2-chloro-4-nitroimidazol-1-yl)-2-hydroxybutyl] 4-methylbenzenesulfonate.
| Compound Name | [(2R)-4-(2-chloro-4-nitroimidazol-1-yl)-2-hydroxybutyl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 86709368 |
| Molecular Formula | C14H16ClN3O6S |
| Molecular Weight | 389.82 g/mol |
| Exact Mass | 389.04 |
| IUPAC Name | [(2R)-4-(2-chloro-4-nitroimidazol-1-yl)-2-hydroxybutyl] 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OC[C@H](O)CCn2cc([N+](=O)[O-])nc2Cl)cc1 |
| InChI | InChI=1S/C14H16ClN3O6S/c1-10-2-4-12(5-3-10)25(22,23)24-9-11(19)6-7-17-8-13(18(20)21)16-14(17)15/h2-5,8,11,19H,6-7,9H2,1H3/t11-/m1/s1 |
| InChIKey | GSWCMXPPPAWKOY-LLVKDONJSA-N |
| XLogP | 1.91 |
| TPSA | 124.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.82 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|