C23H29ClN6O7 — CID 70873680
tert-butyl 4-[5-[(2S)-4-(2-chloro-4-nitroimidazol-1-yl)-2-hydroxybutoxy]-1,3-benzoxazol-2-yl]piperazine-1-carboxylate (PubChem CID 70873680) has the molecular formula C23H29ClN6O7 and a molecular weight of 536.97 g/mol. Its IUPAC name is tert-butyl 4-[5-[(2S)-4-(2-chloro-4-nitroimidazol-1-yl)-2-hydroxybutoxy]-1,3-benzoxazol-2-yl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[5-[(2S)-4-(2-chloro-4-nitroimidazol-1-yl)-2-hydroxybutoxy]-1,3-benzoxazol-2-yl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 70873680 |
| Molecular Formula | C23H29ClN6O7 |
| Molecular Weight | 536.97 g/mol |
| Exact Mass | 536.18 |
| IUPAC Name | tert-butyl 4-[5-[(2S)-4-(2-chloro-4-nitroimidazol-1-yl)-2-hydroxybutoxy]-1,3-benzoxazol-2-yl]piperazine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCN(c2nc3cc(OC[C@@H](O)CCn4cc([N+](=O)[O-])nc4Cl)ccc3o2)CC1 |
| InChI | InChI=1S/C23H29ClN6O7/c1-23(2,3)37-22(32)28-10-8-27(9-11-28)21-25-17-12-16(4-5-18(17)36-21)35-14-15(31)6-7-29-13-19(30(33)34)26-20(29)24/h4-5,12-13,15,31H,6-11,14H2,1-3H3/t15-/m0/s1 |
| InChIKey | MPNGMFBZWGJXRJ-HNNXBMFYSA-N |
| XLogP | 3.47 |
| TPSA | 149.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.97 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|