C31H32ClF3N4O5 — CID 70874641
4-(2-chloro-4-nitroimidazol-1-yl)-1-[6-[4-[2-[4-(trifluoromethoxy)phenyl]ethyl]piperidin-1-yl]naphthalen-2-yl]oxybutan-2-ol (PubChem CID 70874641) has the molecular formula C31H32ClF3N4O5 and a molecular weight of 633.07 g/mol. Its IUPAC name is 4-(2-chloro-4-nitroimidazol-1-yl)-1-[6-[4-[2-[4-(trifluoromethoxy)phenyl]ethyl]piperidin-1-yl]naphthalen-2-yl]oxybutan-2-ol.
| Compound Name | 4-(2-chloro-4-nitroimidazol-1-yl)-1-[6-[4-[2-[4-(trifluoromethoxy)phenyl]ethyl]piperidin-1-yl]naphthalen-2-yl]oxybutan-2-ol |
|---|---|
| PubChem CID | 70874641 |
| Molecular Formula | C31H32ClF3N4O5 |
| Molecular Weight | 633.07 g/mol |
| Exact Mass | 632.20 |
| IUPAC Name | 4-(2-chloro-4-nitroimidazol-1-yl)-1-[6-[4-[2-[4-(trifluoromethoxy)phenyl]ethyl]piperidin-1-yl]naphthalen-2-yl]oxybutan-2-ol |
| SMILES | O=[N+]([O-])c1cn(CCC(O)COc2ccc3cc(N4CCC(CCc5ccc(OC(F)(F)F)cc5)CC4)ccc3c2)c(Cl)n1 |
| InChI | InChI=1S/C31H32ClF3N4O5/c32-30-36-29(39(41)42)19-38(30)16-13-26(40)20-43-28-10-6-23-17-25(7-5-24(23)18-28)37-14-11-22(12-15-37)2-1-21-3-8-27(9-4-21)44-31(33,34)35/h3-10,17-19,22,26,40H,1-2,11-16,20H2 |
| InChIKey | JNENUBALWVNUFM-UHFFFAOYSA-N |
| XLogP | 7.18 |
| TPSA | 102.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 633.07 |
| LogP ≤ 5 | 7.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|