C26H29ClF3N5O5 — CID 70874646
4-(2-chloro-4-nitroimidazol-1-yl)-4-[4-[methyl-[1-[4-(trifluoromethoxy)phenyl]piperidin-4-yl]amino]phenoxy]butan-2-ol (PubChem CID 70874646) has the molecular formula C26H29ClF3N5O5 and a molecular weight of 584.00 g/mol. Its IUPAC name is 4-(2-chloro-4-nitroimidazol-1-yl)-4-[4-[methyl-[1-[4-(trifluoromethoxy)phenyl]piperidin-4-yl]amino]phenoxy]butan-2-ol.
| Compound Name | 4-(2-chloro-4-nitroimidazol-1-yl)-4-[4-[methyl-[1-[4-(trifluoromethoxy)phenyl]piperidin-4-yl]amino]phenoxy]butan-2-ol |
|---|---|
| PubChem CID | 70874646 |
| Molecular Formula | C26H29ClF3N5O5 |
| Molecular Weight | 584.00 g/mol |
| Exact Mass | 583.18 |
| IUPAC Name | 4-(2-chloro-4-nitroimidazol-1-yl)-4-[4-[methyl-[1-[4-(trifluoromethoxy)phenyl]piperidin-4-yl]amino]phenoxy]butan-2-ol |
| SMILES | CC(O)CC(Oc1ccc(N(C)C2CCN(c3ccc(OC(F)(F)F)cc3)CC2)cc1)n1cc([N+](=O)[O-])nc1Cl |
| InChI | InChI=1S/C26H29ClF3N5O5/c1-17(36)15-24(34-16-23(35(37)38)31-25(34)27)39-21-7-3-18(4-8-21)32(2)19-11-13-33(14-12-19)20-5-9-22(10-6-20)40-26(28,29)30/h3-10,16-17,19,24,36H,11-15H2,1-2H3 |
| InChIKey | TWOIVAOKURNCGH-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 106.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.00 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|