C26H30Cl2N4O5 — CID 70873521
4-(2-chloro-4-nitroimidazol-1-yl)-4-[4-[4-[(4-chlorophenyl)methoxymethyl]piperidin-1-yl]phenoxy]butan-2-ol (PubChem CID 70873521) has the molecular formula C26H30Cl2N4O5 and a molecular weight of 549.46 g/mol. Its IUPAC name is 4-(2-chloro-4-nitroimidazol-1-yl)-4-[4-[4-[(4-chlorophenyl)methoxymethyl]piperidin-1-yl]phenoxy]butan-2-ol.
| Compound Name | 4-(2-chloro-4-nitroimidazol-1-yl)-4-[4-[4-[(4-chlorophenyl)methoxymethyl]piperidin-1-yl]phenoxy]butan-2-ol |
|---|---|
| PubChem CID | 70873521 |
| Molecular Formula | C26H30Cl2N4O5 |
| Molecular Weight | 549.46 g/mol |
| Exact Mass | 548.16 |
| IUPAC Name | 4-(2-chloro-4-nitroimidazol-1-yl)-4-[4-[4-[(4-chlorophenyl)methoxymethyl]piperidin-1-yl]phenoxy]butan-2-ol |
| SMILES | CC(O)CC(Oc1ccc(N2CCC(COCc3ccc(Cl)cc3)CC2)cc1)n1cc([N+](=O)[O-])nc1Cl |
| InChI | InChI=1S/C26H30Cl2N4O5/c1-18(33)14-25(31-15-24(32(34)35)29-26(31)28)37-23-8-6-22(7-9-23)30-12-10-20(11-13-30)17-36-16-19-2-4-21(27)5-3-19/h2-9,15,18,20,25,33H,10-14,16-17H2,1H3 |
| InChIKey | RAAYNODWPXGNNA-UHFFFAOYSA-N |
| XLogP | 5.88 |
| TPSA | 102.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.46 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|