C25H27ClF3N5O5 — CID 123316604
4-(2-chloro-4-nitroimidazol-1-yl)-4-[[6-[4-[[4-(trifluoromethoxy)phenyl]methyl]piperidin-1-yl]-3-pyridinyl]oxy]butan-2-ol (PubChem CID 123316604) has the molecular formula C25H27ClF3N5O5 and a molecular weight of 569.97 g/mol. Its IUPAC name is 4-(2-chloro-4-nitroimidazol-1-yl)-4-[[6-[4-[[4-(trifluoromethoxy)phenyl]methyl]piperidin-1-yl]-3-pyridinyl]oxy]butan-2-ol.
| Compound Name | 4-(2-chloro-4-nitroimidazol-1-yl)-4-[[6-[4-[[4-(trifluoromethoxy)phenyl]methyl]piperidin-1-yl]-3-pyridinyl]oxy]butan-2-ol |
|---|---|
| PubChem CID | 123316604 |
| Molecular Formula | C25H27ClF3N5O5 |
| Molecular Weight | 569.97 g/mol |
| Exact Mass | 569.17 |
| IUPAC Name | 4-(2-chloro-4-nitroimidazol-1-yl)-4-[[6-[4-[[4-(trifluoromethoxy)phenyl]methyl]piperidin-1-yl]-3-pyridinyl]oxy]butan-2-ol |
| SMILES | CC(O)CC(Oc1ccc(N2CCC(Cc3ccc(OC(F)(F)F)cc3)CC2)nc1)n1cc([N+](=O)[O-])nc1Cl |
| InChI | InChI=1S/C25H27ClF3N5O5/c1-16(35)12-23(33-15-22(34(36)37)31-24(33)26)38-20-6-7-21(30-14-20)32-10-8-18(9-11-32)13-17-2-4-19(5-3-17)39-25(27,28)29/h2-7,14-16,18,23,35H,8-13H2,1H3 |
| InChIKey | YILYKDPHXGROJO-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 115.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.97 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|