C19H29N3O7 — CID 124887686
tert-butyl (3S,4S)-3-hydroxy-4-[[(2S)-2-hydroxy-3-(3-nitrophenoxy)propyl]-methylamino]pyrrolidine-1-carboxylate (PubChem CID 124887686) has the molecular formula C19H29N3O7 and a molecular weight of 411.46 g/mol. Its IUPAC name is tert-butyl (3S,4S)-3-hydroxy-4-[[(2S)-2-hydroxy-3-(3-nitrophenoxy)propyl]-methylamino]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (3S,4S)-3-hydroxy-4-[[(2S)-2-hydroxy-3-(3-nitrophenoxy)propyl]-methylamino]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 124887686 |
| Molecular Formula | C19H29N3O7 |
| Molecular Weight | 411.46 g/mol |
| Exact Mass | 411.20 |
| IUPAC Name | tert-butyl (3S,4S)-3-hydroxy-4-[[(2S)-2-hydroxy-3-(3-nitrophenoxy)propyl]-methylamino]pyrrolidine-1-carboxylate |
| SMILES | CN(C[C@H](O)COc1cccc([N+](=O)[O-])c1)[C@H]1CN(C(=O)OC(C)(C)C)C[C@@H]1O |
| InChI | InChI=1S/C19H29N3O7/c1-19(2,3)29-18(25)21-10-16(17(24)11-21)20(4)9-14(23)12-28-15-7-5-6-13(8-15)22(26)27/h5-8,14,16-17,23-24H,9-12H2,1-4H3/t14-,16-,17-/m0/s1 |
| InChIKey | HDDMFRRWJDXSMB-XIRDDKMYSA-N |
| XLogP | 1.25 |
| TPSA | 125.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.46 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|