C22H25FN2O6 — CID 121372367
tert-butyl (2S,4R)-2-[(4-fluorophenoxy)methyl]-4-(3-nitrophenoxy)pyrrolidine-1-carboxylate (PubChem CID 121372367) has the molecular formula C22H25FN2O6 and a molecular weight of 432.45 g/mol. Its IUPAC name is tert-butyl (2S,4R)-2-[(4-fluorophenoxy)methyl]-4-(3-nitrophenoxy)pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (2S,4R)-2-[(4-fluorophenoxy)methyl]-4-(3-nitrophenoxy)pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 121372367 |
| Molecular Formula | C22H25FN2O6 |
| Molecular Weight | 432.45 g/mol |
| Exact Mass | 432.17 |
| IUPAC Name | tert-butyl (2S,4R)-2-[(4-fluorophenoxy)methyl]-4-(3-nitrophenoxy)pyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1C[C@H](Oc2cccc([N+](=O)[O-])c2)C[C@H]1COc1ccc(F)cc1 |
| InChI | InChI=1S/C22H25FN2O6/c1-22(2,3)31-21(26)24-13-20(30-19-6-4-5-16(11-19)25(27)28)12-17(24)14-29-18-9-7-15(23)8-10-18/h4-11,17,20H,12-14H2,1-3H3/t17-,20+/m0/s1 |
| InChIKey | VYGUXZSMINWVOQ-FXAWDEMLSA-N |
| XLogP | 4.57 |
| TPSA | 91.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.45 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|