C22H29N3O4 — CID 90179003
tert-butyl (2S,4R)-4-(3-aminophenoxy)-2-[(3-aminophenoxy)methyl]pyrrolidine-1-carboxylate (PubChem CID 90179003) has the molecular formula C22H29N3O4 and a molecular weight of 399.49 g/mol. Its IUPAC name is tert-butyl (2S,4R)-4-(3-aminophenoxy)-2-[(3-aminophenoxy)methyl]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (2S,4R)-4-(3-aminophenoxy)-2-[(3-aminophenoxy)methyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 90179003 |
| Molecular Formula | C22H29N3O4 |
| Molecular Weight | 399.49 g/mol |
| Exact Mass | 399.22 |
| IUPAC Name | tert-butyl (2S,4R)-4-(3-aminophenoxy)-2-[(3-aminophenoxy)methyl]pyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1C[C@H](Oc2cccc(N)c2)C[C@H]1COc1cccc(N)c1 |
| InChI | InChI=1S/C22H29N3O4/c1-22(2,3)29-21(26)25-13-20(28-19-9-5-7-16(24)11-19)12-17(25)14-27-18-8-4-6-15(23)10-18/h4-11,17,20H,12-14,23-24H2,1-3H3/t17-,20+/m0/s1 |
| InChIKey | FMFNURQJCAWZIF-FXAWDEMLSA-N |
| XLogP | 3.69 |
| TPSA | 100.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.49 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|