C20H26ClNO5 — CID 167229176
tert-butyl (2S,4S)-4-(3-chlorophenoxy)-2-[(E)-3-ethoxy-3-oxoprop-1-enyl]pyrrolidine-1-carboxylate (PubChem CID 167229176) has the molecular formula C20H26ClNO5 and a molecular weight of 395.88 g/mol. Its IUPAC name is tert-butyl (2S,4S)-4-(3-chlorophenoxy)-2-[(E)-3-ethoxy-3-oxoprop-1-enyl]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (2S,4S)-4-(3-chlorophenoxy)-2-[(E)-3-ethoxy-3-oxoprop-1-enyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 167229176 |
| Molecular Formula | C20H26ClNO5 |
| Molecular Weight | 395.88 g/mol |
| Exact Mass | 395.15 |
| IUPAC Name | tert-butyl (2S,4S)-4-(3-chlorophenoxy)-2-[(E)-3-ethoxy-3-oxoprop-1-enyl]pyrrolidine-1-carboxylate |
| SMILES | CCOC(=O)/C=C/[C@@H]1C[C@H](Oc2cccc(Cl)c2)CN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C20H26ClNO5/c1-5-25-18(23)10-9-15-12-17(26-16-8-6-7-14(21)11-16)13-22(15)19(24)27-20(2,3)4/h6-11,15,17H,5,12-13H2,1-4H3/b10-9+/t15-,17+/m1/s1 |
| InChIKey | ZXIPCIUIQBNIOV-AMMZPXFLSA-N |
| XLogP | 4.22 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.88 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|