C24H29NO6 — CID 67405693
tert-butyl 2-[(4-methoxycarbonylphenoxy)methyl]-4-phenoxypyrrolidine-1-carboxylate (PubChem CID 67405693) has the molecular formula C24H29NO6 and a molecular weight of 427.50 g/mol. Its IUPAC name is tert-butyl 2-[(4-methoxycarbonylphenoxy)methyl]-4-phenoxypyrrolidine-1-carboxylate.
| Compound Name | tert-butyl 2-[(4-methoxycarbonylphenoxy)methyl]-4-phenoxypyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 67405693 |
| Molecular Formula | C24H29NO6 |
| Molecular Weight | 427.50 g/mol |
| Exact Mass | 427.20 |
| IUPAC Name | tert-butyl 2-[(4-methoxycarbonylphenoxy)methyl]-4-phenoxypyrrolidine-1-carboxylate |
| SMILES | COC(=O)c1ccc(OCC2CC(Oc3ccccc3)CN2C(=O)OC(C)(C)C)cc1 |
| InChI | InChI=1S/C24H29NO6/c1-24(2,3)31-23(27)25-15-21(30-20-8-6-5-7-9-20)14-18(25)16-29-19-12-10-17(11-13-19)22(26)28-4/h5-13,18,21H,14-16H2,1-4H3 |
| InChIKey | MYHZTLYGOZVUSE-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 74.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.50 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |