C17H27N3O6 — CID 95789244
(2S)-1-[2-hydroxyethyl(2-morpholin-4-ylethyl)amino]-3-(3-nitrophenoxy)propan-2-ol (PubChem CID 95789244) has the molecular formula C17H27N3O6 and a molecular weight of 369.42 g/mol. Its IUPAC name is (2S)-1-[2-hydroxyethyl(2-morpholin-4-ylethyl)amino]-3-(3-nitrophenoxy)propan-2-ol.
| Compound Name | (2S)-1-[2-hydroxyethyl(2-morpholin-4-ylethyl)amino]-3-(3-nitrophenoxy)propan-2-ol |
|---|---|
| PubChem CID | 95789244 |
| Molecular Formula | C17H27N3O6 |
| Molecular Weight | 369.42 g/mol |
| Exact Mass | 369.19 |
| IUPAC Name | (2S)-1-[2-hydroxyethyl(2-morpholin-4-ylethyl)amino]-3-(3-nitrophenoxy)propan-2-ol |
| SMILES | O=[N+]([O-])c1cccc(OC[C@@H](O)CN(CCO)CCN2CCOCC2)c1 |
| InChI | InChI=1S/C17H27N3O6/c21-9-6-19(5-4-18-7-10-25-11-8-18)13-16(22)14-26-17-3-1-2-15(12-17)20(23)24/h1-3,12,16,21-22H,4-11,13-14H2/t16-/m0/s1 |
| InChIKey | OWNQHYYFJVRFEI-INIZCTEOSA-N |
| XLogP | -0.04 |
| TPSA | 108.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.42 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|