C18H17ClF3NO3 — CID 70873529
2-chloro-4-[4-[4-(trifluoromethoxy)phenoxy]piperidin-1-yl]phenol (PubChem CID 70873529) has the molecular formula C18H17ClF3NO3 and a molecular weight of 387.79 g/mol. Its IUPAC name is 2-chloro-4-[4-[4-(trifluoromethoxy)phenoxy]piperidin-1-yl]phenol.
| Compound Name | 2-chloro-4-[4-[4-(trifluoromethoxy)phenoxy]piperidin-1-yl]phenol |
|---|---|
| PubChem CID | 70873529 |
| Molecular Formula | C18H17ClF3NO3 |
| Molecular Weight | 387.79 g/mol |
| Exact Mass | 387.08 |
| IUPAC Name | 2-chloro-4-[4-[4-(trifluoromethoxy)phenoxy]piperidin-1-yl]phenol |
| SMILES | Oc1ccc(N2CCC(Oc3ccc(OC(F)(F)F)cc3)CC2)cc1Cl |
| InChI | InChI=1S/C18H17ClF3NO3/c19-16-11-12(1-6-17(16)24)23-9-7-14(8-10-23)25-13-2-4-15(5-3-13)26-18(20,21)22/h1-6,11,14,24H,7-10H2 |
| InChIKey | PZWIVVLGIJVLPP-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 41.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.79 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |