C15H15F3N4O3 — CID 167314568
triazol-1-yl-[4-[4-(trifluoromethoxy)phenoxy]piperidin-1-yl]methanone (PubChem CID 167314568) has the molecular formula C15H15F3N4O3 and a molecular weight of 356.30 g/mol. Its IUPAC name is triazol-1-yl-[4-[4-(trifluoromethoxy)phenoxy]piperidin-1-yl]methanone.
| Compound Name | triazol-1-yl-[4-[4-(trifluoromethoxy)phenoxy]piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 167314568 |
| Molecular Formula | C15H15F3N4O3 |
| Molecular Weight | 356.30 g/mol |
| Exact Mass | 356.11 |
| IUPAC Name | triazol-1-yl-[4-[4-(trifluoromethoxy)phenoxy]piperidin-1-yl]methanone |
| SMILES | O=C(N1CCC(Oc2ccc(OC(F)(F)F)cc2)CC1)n1ccnn1 |
| InChI | InChI=1S/C15H15F3N4O3/c16-15(17,18)25-13-3-1-11(2-4-13)24-12-5-8-21(9-6-12)14(23)22-10-7-19-20-22/h1-4,7,10,12H,5-6,8-9H2 |
| InChIKey | ACYDLXNHRTZKMZ-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 69.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.30 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |