C16H19F3N2O5 — CID 67529467
[(2S)-1-oxo-1-[4-[4-(trifluoromethoxy)phenoxy]piperidin-1-yl]propan-2-yl]carbamic acid (PubChem CID 67529467) has the molecular formula C16H19F3N2O5 and a molecular weight of 376.33 g/mol. Its IUPAC name is [(2S)-1-oxo-1-[4-[4-(trifluoromethoxy)phenoxy]piperidin-1-yl]propan-2-yl]carbamic acid.
| Compound Name | [(2S)-1-oxo-1-[4-[4-(trifluoromethoxy)phenoxy]piperidin-1-yl]propan-2-yl]carbamic acid |
|---|---|
| PubChem CID | 67529467 |
| Molecular Formula | C16H19F3N2O5 |
| Molecular Weight | 376.33 g/mol |
| Exact Mass | 376.12 |
| IUPAC Name | [(2S)-1-oxo-1-[4-[4-(trifluoromethoxy)phenoxy]piperidin-1-yl]propan-2-yl]carbamic acid |
| SMILES | C[C@H](NC(=O)O)C(=O)N1CCC(Oc2ccc(OC(F)(F)F)cc2)CC1 |
| InChI | InChI=1S/C16H19F3N2O5/c1-10(20-15(23)24)14(22)21-8-6-12(7-9-21)25-11-2-4-13(5-3-11)26-16(17,18)19/h2-5,10,12,20H,6-9H2,1H3,(H,23,24)/t10-/m0/s1 |
| InChIKey | VNSQSMQMNZWFMN-JTQLQIEISA-N |
| XLogP | 2.61 |
| TPSA | 88.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.33 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |