C17H25N3O3 — CID 94636207
[(2R)-1-[4-(2,6-dimethylphenoxy)piperidin-1-yl]-1-oxopropan-2-yl]urea (PubChem CID 94636207) has the molecular formula C17H25N3O3 and a molecular weight of 319.41 g/mol. Its IUPAC name is [(2R)-1-[4-(2,6-dimethylphenoxy)piperidin-1-yl]-1-oxopropan-2-yl]urea.
| Compound Name | [(2R)-1-[4-(2,6-dimethylphenoxy)piperidin-1-yl]-1-oxopropan-2-yl]urea |
|---|---|
| PubChem CID | 94636207 |
| Molecular Formula | C17H25N3O3 |
| Molecular Weight | 319.41 g/mol |
| Exact Mass | 319.19 |
| IUPAC Name | [(2R)-1-[4-(2,6-dimethylphenoxy)piperidin-1-yl]-1-oxopropan-2-yl]urea |
| SMILES | Cc1cccc(C)c1OC1CCN(C(=O)[C@@H](C)NC(N)=O)CC1 |
| InChI | InChI=1S/C17H25N3O3/c1-11-5-4-6-12(2)15(11)23-14-7-9-20(10-8-14)16(21)13(3)19-17(18)22/h4-6,13-14H,7-10H2,1-3H3,(H3,18,19,22)/t13-/m1/s1 |
| InChIKey | PIBTTYCDDGUXBO-CYBMUJFWSA-N |
| XLogP | 1.73 |
| TPSA | 84.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.41 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |