C17H24ClN3O3 — CID 95869074
[(2R)-1-[4-(4-chlorophenoxy)piperidin-1-yl]-3-methyl-1-oxobutan-2-yl]urea (PubChem CID 95869074) has the molecular formula C17H24ClN3O3 and a molecular weight of 353.85 g/mol. Its IUPAC name is [(2R)-1-[4-(4-chlorophenoxy)piperidin-1-yl]-3-methyl-1-oxobutan-2-yl]urea.
| Compound Name | [(2R)-1-[4-(4-chlorophenoxy)piperidin-1-yl]-3-methyl-1-oxobutan-2-yl]urea |
|---|---|
| PubChem CID | 95869074 |
| Molecular Formula | C17H24ClN3O3 |
| Molecular Weight | 353.85 g/mol |
| Exact Mass | 353.15 |
| IUPAC Name | [(2R)-1-[4-(4-chlorophenoxy)piperidin-1-yl]-3-methyl-1-oxobutan-2-yl]urea |
| SMILES | CC(C)[C@@H](NC(N)=O)C(=O)N1CCC(Oc2ccc(Cl)cc2)CC1 |
| InChI | InChI=1S/C17H24ClN3O3/c1-11(2)15(20-17(19)23)16(22)21-9-7-14(8-10-21)24-13-5-3-12(18)4-6-13/h3-6,11,14-15H,7-10H2,1-2H3,(H3,19,20,23)/t15-/m1/s1 |
| InChIKey | MMPBFTLDPYCOCG-OAHLLOKOSA-N |
| XLogP | 2.40 |
| TPSA | 84.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.85 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |