C18H24ClNO4 — CID 70096196
6-[4-(4-chlorophenoxy)piperidin-1-yl]-3-methyl-6-oxohexanoic acid (PubChem CID 70096196) has the molecular formula C18H24ClNO4 and a molecular weight of 353.85 g/mol. Its IUPAC name is 6-[4-(4-chlorophenoxy)piperidin-1-yl]-3-methyl-6-oxohexanoic acid.
| Compound Name | 6-[4-(4-chlorophenoxy)piperidin-1-yl]-3-methyl-6-oxohexanoic acid |
|---|---|
| PubChem CID | 70096196 |
| Molecular Formula | C18H24ClNO4 |
| Molecular Weight | 353.85 g/mol |
| Exact Mass | 353.14 |
| IUPAC Name | 6-[4-(4-chlorophenoxy)piperidin-1-yl]-3-methyl-6-oxohexanoic acid |
| SMILES | CC(CCC(=O)N1CCC(Oc2ccc(Cl)cc2)CC1)CC(=O)O |
| InChI | InChI=1S/C18H24ClNO4/c1-13(12-18(22)23)2-7-17(21)20-10-8-16(9-11-20)24-15-5-3-14(19)4-6-15/h3-6,13,16H,2,7-12H2,1H3,(H,22,23) |
| InChIKey | CZDYDQAQKJHGFY-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.85 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |