C17H25NO2S — CID 124569340
(3S)-1-[4-(4-methylphenoxy)piperidin-1-yl]-3-methylsulfanylbutan-1-one (PubChem CID 124569340) has the molecular formula C17H25NO2S and a molecular weight of 307.46 g/mol. Its IUPAC name is (3S)-1-[4-(4-methylphenoxy)piperidin-1-yl]-3-methylsulfanylbutan-1-one.
| Compound Name | (3S)-1-[4-(4-methylphenoxy)piperidin-1-yl]-3-methylsulfanylbutan-1-one |
|---|---|
| PubChem CID | 124569340 |
| Molecular Formula | C17H25NO2S |
| Molecular Weight | 307.46 g/mol |
| Exact Mass | 307.16 |
| IUPAC Name | (3S)-1-[4-(4-methylphenoxy)piperidin-1-yl]-3-methylsulfanylbutan-1-one |
| SMILES | CS[C@@H](C)CC(=O)N1CCC(Oc2ccc(C)cc2)CC1 |
| InChI | InChI=1S/C17H25NO2S/c1-13-4-6-15(7-5-13)20-16-8-10-18(11-9-16)17(19)12-14(2)21-3/h4-7,14,16H,8-12H2,1-3H3/t14-/m0/s1 |
| InChIKey | MVRZXBFEXLICCU-AWEZNQCLSA-N |
| XLogP | 3.51 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.46 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |