C8H15N3O4 — CID 79410835
[1-[(3S,4R)-3,4-dihydroxypyrrolidin-1-yl]-1-oxopropan-2-yl]urea (PubChem CID 79410835) has the molecular formula C8H15N3O4 and a molecular weight of 217.22 g/mol. Its IUPAC name is [1-[(3S,4R)-3,4-dihydroxypyrrolidin-1-yl]-1-oxopropan-2-yl]urea.
| Compound Name | [1-[(3S,4R)-3,4-dihydroxypyrrolidin-1-yl]-1-oxopropan-2-yl]urea |
|---|---|
| PubChem CID | 79410835 |
| Molecular Formula | C8H15N3O4 |
| Molecular Weight | 217.22 g/mol |
| Exact Mass | 217.11 |
| IUPAC Name | [1-[(3S,4R)-3,4-dihydroxypyrrolidin-1-yl]-1-oxopropan-2-yl]urea |
| SMILES | CC(NC(N)=O)C(=O)N1C[C@@H](O)[C@@H](O)C1 |
| InChI | InChI=1S/C8H15N3O4/c1-4(10-8(9)15)7(14)11-2-5(12)6(13)3-11/h4-6,12-13H,2-3H2,1H3,(H3,9,10,15)/t4?,5-,6+ |
| InChIKey | XGHYVCYXBBQXRF-GOHHTPAQSA-N |
| XLogP | -2.39 |
| TPSA | 115.89 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.22 |
| LogP ≤ 5 | -2.39 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |