C12H22N4O3 — CID 47102273
[1-[4-(2-methylpropanoyl)piperazin-1-yl]-1-oxopropan-2-yl]urea (PubChem CID 47102273) has the molecular formula C12H22N4O3 and a molecular weight of 270.33 g/mol. Its IUPAC name is [1-[4-(2-methylpropanoyl)piperazin-1-yl]-1-oxopropan-2-yl]urea.
| Compound Name | [1-[4-(2-methylpropanoyl)piperazin-1-yl]-1-oxopropan-2-yl]urea |
|---|---|
| PubChem CID | 47102273 |
| Molecular Formula | C12H22N4O3 |
| Molecular Weight | 270.33 g/mol |
| Exact Mass | 270.17 |
| IUPAC Name | [1-[4-(2-methylpropanoyl)piperazin-1-yl]-1-oxopropan-2-yl]urea |
| SMILES | CC(C)C(=O)N1CCN(C(=O)C(C)NC(N)=O)CC1 |
| InChI | InChI=1S/C12H22N4O3/c1-8(2)10(17)15-4-6-16(7-5-15)11(18)9(3)14-12(13)19/h8-9H,4-7H2,1-3H3,(H3,13,14,19) |
| InChIKey | RCWAZKMKBJUYOY-UHFFFAOYSA-N |
| XLogP | -0.63 |
| TPSA | 95.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.33 |
| LogP ≤ 5 | -0.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |